A1434950
AristolochicacidC , ≥95% , 4849-90-5
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB456.00 | In Stock |
|
| 5mg | RMB959.20 | In Stock |
|
| 10mg | RMB1599.20 | In Stock |
|
| 25mg | RMB3199.20 | In Stock |
|
| 100mg | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 287～292℃ |
| Boiling point: | 658.7±55.0 °C(Predicted) |
| Density | 1.707±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 3.01±0.20(Predicted) |
| color | Dark Orange |
| Water Solubility | sparingly soluble in water |
| Major Application | food and beverages |
| InChI | 1S/C16H9NO7/c18-8-2-1-7-3-11(17(21)22)13-10(16(19)20)5-12-15(24-6-23-12)14(13)9(7)4-8/h1-5,18H,6H2,(H,19,20) |
| InChIKey | NBFGYDJKTHENDP-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1c2c(c4c(c1)ccc(c4)O)c3c(cc2C(=O)O)OCO3 |
Description and Uses
A metabolite of carcinogenic Aristolochic acids (AAs).
Safety
| Symbol(GHS) |   GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H310-H341-H330-H351-H300 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P201-P202-P281-P308+P313-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Carc. 2 Muta. 2 |
