M3517357
AristolochicacidD , ≥98% , 17413-38-6
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1832.00 | In Stock |
|
| 5mg | RMB5488.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO; |
| form | powder |
| color | Orange-red |
| Water Solubility | sparingly soluble in water |
| Major Application | food and beverages |
| InChI | InChI=1S/C17H11NO8/c1-24-12-3-7(19)2-9-8(12)4-11(18(22)23)14-10(17(20)21)5-13-16(15(9)14)26-6-25-13/h2-5,19H,6H2,1H3,(H,20,21) |
| InChIKey | PADIFGYTAXNCRK-UHFFFAOYSA-N |
| SMILES | O1C2=C3C(=C(C(O)=O)C=C2OC1)C([N+]([O-])=O)=CC1C3=CC(O)=CC=1OC |
Description and Uses
A derivative of carcinogenic Aristolochic acids (AAs).
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H341-H351 |
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P301+P310-P321-P330-P302+P352-P304+P340-P308+P313-P312-P361+P364-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Carc. 2 Muta. 2 |






