A1435412
2-Bromo-2’-MethoxyAcetophenone , 98% , 31949-21-0
Synonym(s):
2′-Methoxyphenacyl bromide
CAS NO.:31949-21-0
Empirical Formula: C9H9BrO2
Molecular Weight: 229.07
MDL number: MFCD00000196
EINECS: 250-870-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB144.80 | In Stock |
|
| 10G | RMB263.20 | In Stock |
|
| 25G | RMB503.20 | In Stock |
|
| 100G | RMB1799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-45 °C(lit.) |
| Boiling point: | 130 °C1 mm Hg(lit.) |
| Density | 1.4921 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| Sensitive | Lachrymatory |
| BRN | 1938788 |
| InChI | InChI=1S/C9H9BrO2/c1-12-9-5-3-2-4-7(9)8(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | GKNCPTLOPRDYMH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1OC)CBr |
| CAS DataBase Reference | 31949-21-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-2'-methoxyacetophenone is used as a pharmaceutical intermediate .
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T |
| Risk Statements | 34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Lachrymatory/Toxic/Keep Cold |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






