A1437550
(2R,3R)-(+)-Bis(diphenylphosphino)butane , ≥97%,≥99%ee , 74839-84-2
Synonym(s):
(R,R)-Chiraphos
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB102.40 | In Stock |
|
| 1g | RMB317.60 | In Stock |
|
| 5g | RMB1263.20 | In Stock |
|
| 25g | RMB5479.20 | In Stock |
|
| 100g | RMB15199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-109 °C |
| Boiling point: | 529.2±33.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | white |
| Sensitive | Air Sensitive |
| InChI | 1S/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | FWXAUDSWDBGCMN-DNQXCXABSA-N |
| SMILES | C[C@H]([C@@H](C)P(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4 |
| CAS DataBase Reference | 74839-84-2 |
Description and Uses
(2R,3R)-Bis(diphenylphosphino)butane is a reagent used in the synthesis of endothelin A receptor antagonists. Also used in the synthesis of (R)-Tolterodine and (S)-Tolterodine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39-26-37/39 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![(2R,3R)-(-)-2,3-Bis(diphenylphosphino)bicyclo[2.2.1]hept-5-ene](https://img.chemicalbook.com/CAS/GIF/71042-55-2.gif)
