A1441612
4-Bromo-4'-pentylbiphenyl , ≥99.0%(GC) , 63619-59-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB136.80 | In Stock |
|
| 25G | RMB588.00 | In Stock |
|
| 100G | RMB1532.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98 °C |
| Boiling point: | 200-202 °C(Press: 0.5 Torr) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C17H19Br/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h6-13H,2-5H2,1H3 |
| InChIKey | VXJTWTJULLKDPY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCCCC)C=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 63619-59-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2903.99.8001 |
