A1442012
2-Bromo-4-Methoxybenzaldehyde , 97% , 43192-31-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB144.80 | In Stock |
|
| 25G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-69℃ |
| Boiling point: | 284℃ |
| Density | 1.522 |
| Flash point: | 126℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H7BrO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-5H,1H3 |
| InChIKey | ODISAUHBLBVQKC-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC)C=C1Br |
| CAS DataBase Reference | 43192-31-0 |
Description and Uses
2-Bromo-4-methoxybenzaldehyde is an organic compound that is often used as an intermediate in organic synthesis, especially in pharmaceutical and pesticide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2912490090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





![(8-Bromo-3,4-dihydro-2H-benzo[b][1,4]dioxepin-7-yl)(phenyl)methanone](https://img.chemicalbook.com/CAS/GIF/175136-38-6.gif)
