A1442912
3-(3-Benzothienyl)-N-Fmoc-L-alanine , 95% , 177966-60-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB140.00 | In Stock |
|
| 1G | RMB511.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 690.8±55.0 °C(Predicted) |
| Density | 1.356±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | Solid |
| pka | 3.74±0.10(Predicted) |
| color | White to off-white |
| optical activity | -43.8° (C=0.01 g/ml, DMF) |
| InChIKey | BQIZNDWONIMCGM-CRPMJUFNNA-N |
| SMILES | C(C1C2=CC=CC=C2C2C=CC=CC1=2)OC(=O)N[C@H](C(=O)O)CC1=CSC2C=CC=CC1=2 |&1:18,r| |
| CAS DataBase Reference | 177966-60-8(CAS DataBase Reference) |
Description and Uses
It is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Alanine is one of the simplest amino acids - a methyl group as the side chain. This small side chain confers a high degree of flexibility (second only to glycine) when incorporated into a polypeptide chain. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H319-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |






