A1443112
4-Bromo-3-chlorobenzoic Acid , ≥98.0%(GC) , 25118-59-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-224 °C |
| Boiling point: | 333.7±27.0 °C(Predicted) |
| Density | 1.809±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.60±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4BrClO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | PSKJIHDVFDVNBU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(Cl)=C1 |
| CAS DataBase Reference | 25118-59-6 |
Description and Uses
4-Bromo-3-chlorobenzoic acid is a molecule that belongs to the class of antimicrobial compounds and is used for the treatment of gram-negative pathogens. It inhibits the growth of these bacteria by blocking their ability to synthesize DNA, RNA, and proteins.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P273-P301+P310+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |






