A0761312
5-Amino-2-bromobenzoic acid , 95% , 2840-02-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB314.40 | In Stock |
|
| 100g | RMB1000.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-179 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Brown |
| Water Solubility | Slightly soluble in water. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6BrNO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | FEXDUVBQBNYSQV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(N)=CC=C1Br |
| CAS DataBase Reference | 2840-02-0(CAS DataBase Reference) |
Description and Uses
5-Amino-2-bromobenzoic Acid can be used for FABP4 and FABP4 inhibitors to prevent or treat FABP 4/5 related diseases.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| HS Code | 2922498590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






