A1443812
3-Benzyloxy-4-methoxybenzaldehyde , ≥97.0%(GC) , 6346-05-0
CAS NO.:6346-05-0
Empirical Formula: C15H14O3
Molecular Weight: 242.27
MDL number: MFCD00003386
EINECS: 228-752-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB64.80 | In Stock |
|
| 10G | RMB122.40 | In Stock |
|
| 25g | RMB267.20 | In Stock |
|
| 50G | RMB503.20 | In Stock |
|
| 100g | RMB964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C (lit.) |
| Boiling point: | 120 °C / 5mmHg |
| Density | 1.1515 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Dichloromethane, Ethyl Acetate, Methanol |
| form | Solid |
| color | Pale Yellow |
| Sensitive | Air Sensitive |
| BRN | 794627 |
| InChI | InChI=1S/C15H14O3/c1-17-14-8-7-13(10-16)9-15(14)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | VQVQZFHUXRSRBZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC)C(OCC2=CC=CC=C2)=C1 |
| CAS DataBase Reference | 6346-05-0(CAS DataBase Reference) |
Description and Uses
3-Benzyloxy-4-methoxybenzaldehyde was used in the synthesis of (+)-9-benzyloxy-α-dihydrotetrabenazine. It was also used in total synthesis of (-)-galipeine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |





