A1444512
2-Bromo-4-chloroaniline , ≥98.0%(GC) , 873-38-1
CAS NO.：873-38-1
Empirical Formula: C6H5BrClN
Molecular Weight: 206.47
MDL number: MFCD00041313
EINECS: 212-837-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB303.20 | In Stock |
|
| 500g | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-68 °C (lit.) |
| Boiling point: | 127°C 14mm |
| Density | 1.722±0.06 g/cm3(Predicted) |
| Flash point: | 127°C/20mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 1.90±0.10(Predicted) |
| form | Crystalline Powder |
| color | Pale brown |
| BRN | 2802563 |
| InChI | InChI=1S/C6H5BrClN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | SYTBIFURTZACKR-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 873-38-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-4-chloroaniline(873-38-1) |
Description and Uses
2-Bromo-4-chloroaniline may be used in the preparation of:
- 2-bromo-4-chloro-N-tosylaniline
- 2-bromo-4-chlorothiophenol
- 7-chloro-4a-methyl-4,4a,9,9a-tetrahydro-1H-carbazol-2(3H)-one
Safety
| Symbol(GHS) |    GHS07,GHS06,GHS08 |
| Signal word | Warning |
| Hazard statements | H301-H302+H312+H332-H302-H311-H332-H373-H315-H319-H335 |
| Precautionary statements | P280h-P302+P352-P309-P310-P261-P305+P351+P338-P280a-P301+P310a-P405-P501a-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
