A1445312
6-bromo-4-chloroquinoline , 96% , 65340-70-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB181.60 | In Stock |
|
| 25g | RMB635.20 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112℃ |
| Boiling point: | 314.6±22.0 °C(Predicted) |
| Density | 1.673±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | solid |
| pka | 2.76±0.16(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C9H5BrClN/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H |
| InChIKey | KJILYZMXTLCPDQ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C(Cl)=CC=1 |
Description and Uses
6-Bromo-4-chloroquinoline belongs to the class of heterocyclic compounds and has been used in the synthesis of other compounds, such as pharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 25-20/22 |
| Safety Statements | 45-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |







