A1446712
4-Bromo-2-nitroanisole , 97% , 33696-00-3
CAS NO.:33696-00-3
Empirical Formula: C7H6BrNO3
Molecular Weight: 232.03
MDL number: MFCD00055529
EINECS: 251-642-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB137.60 | In Stock |
|
| 100G | RMB392.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87 °C |
| Boiling point: | 303.3±22.0 °C(Predicted) |
| Density | 1.640 |
| storage temp. | 2-8°C |
| form | Solid |
| color | Light yellow to Yellow to Green |
| InChI | 1S/C7H6BrNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| InChIKey | ORBHQHXVVMZIDP-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1[N+]([O-])=O |
| CAS DataBase Reference | 33696-00-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2909309090 |
| Storage Class | 11 - Combustible Solids |



![6,7-Dibromo-8-nitro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/66411-18-5.gif)


