A1447912
Boc-β-(2-thienyl)-Ala-OH , ≥98.0%(HPLC) , 56675-37-7
Synonym(s):
Boc-3-(2-thienyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB224.64 | In Stock |
|
| 1G | RMB279.20 | In Stock |
|
| 5G | RMB555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-76 °C |
| alpha | 11 º (c=1% in MeOH) |
| Density | 1.2791 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D +11.0±2°, c = 1% in methanol |
| BRN | 1388299 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H17NO4S/c1-12(2,3)17-11(16)13-9(10(14)15)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,13,16)(H,14,15)/t9-/s3 |
| InChIKey | OJLISTAWQHSIHL-DJEYLCQNNA-N |
| SMILES | [C@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1SC=CC=1 |&1:0,r| |
| CAS DataBase Reference | 56675-37-7(CAS DataBase Reference) |
Description and Uses
Boc-β-(2-thienyl)-Ala-OH may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |







