BD8674031
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(o-tolyl)propanoic acid , 95% , 211637-75-1
Synonym(s):
Fmoc-2-methyl-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB58.40 | In Stock |
|
| 1g | RMB199.20 | In Stock |
|
| 5g | RMB911.20 | In Stock |
|
| 10g | RMB1536.80 | In Stock |
|
| 25g | RMB3418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118°C |
| alpha | -45 º (c=1,DMF) |
| Boiling point: | 631.1±55.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.81±0.11(Predicted) |
| color | White to off-white |
| BRN | 9157614 |
| Major Application | peptide synthesis |
| InChIKey | GYFMRMRGTNDDAT-QHCPKHFHSA-N |
| SMILES | Cc1ccccc1C[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(O)=O |
| CAS DataBase Reference | 211637-75-1(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 13 - Non Combustible Solids |







