A1448112
4'-Bromo-2'-hydroxyacetophenone , 95% , 30186-18-6
CAS NO.:30186-18-6
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD03428533
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25g | RMB370.40 | In Stock |
|
| 100g | RMB1391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40.0 to 44.0 °C |
| Boiling point: | 83°C/7mmHg(lit.) |
| Density | 1.586±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| pka | 9.20±0.10(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H7BrO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,1H3 |
| InChIKey | LQCMMXGKEGWUIM-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Br)C=C1O)C |
Description and Uses
4'-Bromo-2'-hydroxyacetophenone is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1759 |
| WGK Germany | WGK 3 |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






