A1456212
Boc-Nva-OH , ≥98.0% , 53308-95-5
Synonym(s):
Boc-L -norvaline;Boc-Nva-OH;N-α-t.-Boc-L-norvaline
CAS NO.：53308-95-5
Empirical Formula: C10H19NO4
Molecular Weight: 217.26
MDL number: MFCD00037268
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB291.20 | In Stock |
|
| 100G | RMB943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-47 °C |
| Boiling point: | 357.82°C (rough estimate) |
| Density | 1.1518 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 4.02±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 3607582 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | INWOAUUPYIXDHN-ZETCQYMHSA-N |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
Description and Uses
BOC-L-Norvaline is used in the synthesis of α-amino acid ester prodrugs used as cytotoxic agents against human lung cancer.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS02 |
| Signal word | Danger |
| Hazard statements | H311-H315-H318-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P361+P364-P303+P361+P353-P332+P313-P305+P351+P338+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 10 - Combustible liquids |
