A1458512
2-Bromo-6-chlorotoluene , ≥96.0%(GC) , 62356-27-8
CAS NO.：62356-27-8
Empirical Formula: C7H6BrCl
Molecular Weight: 205.48
MDL number: MFCD00061121
EINECS: 263-520-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB236.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100°C 25mm |
| Density | 1,56 g/cm3 |
| refractive index | 1.5780 |
| Flash point: | 95°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.58 |
| color | Colorless to Light red to Green |
| InChI | InChI=1S/C7H6BrCl/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| InChIKey | DMARBQGIQKLIPM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(Cl)=C1C |
| CAS DataBase Reference | 62356-27-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50-22-36/38 |
| Safety Statements | 26-37-61 |
| HazardClass | IRRITANT |
| HS Code | 29038900 |
