A1460612
Boc-Phe-OMe , 98% , 51987-73-6
Synonym(s):
N-(tert-Butoxycarbonyl)-L -phenylalanine methyl ester;Boc-L -phenylalanine methyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB177.60 | In Stock |
|
| 100G | RMB662.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-40 °C(lit.) |
| Boiling point: | 403.7±38.0 °C(Predicted) |
| Density | 1.099±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.17±0.46(Predicted) |
| form | Powder |
| color | Off-white |
| optical activity | [α]22/D 4.0°, c = 2 in methanol |
| BRN | 3061910 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H21NO4/c1-15(2,3)20-14(18)16-12(13(17)19-4)10-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | SDSWSVBXRBXPRL-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| CAS DataBase Reference | 51987-73-6(CAS DataBase Reference) |
Description and Uses
Boc-L-phenylalanine Methyl Ester is used in the synthetic preparation of O-benzyl salicylamides built from leucine and phenylalanine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-41-36 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |






