A1461812
2-Bromo-4-fluoro-1-nitrobenzene , ≥98.0%(GC) , 700-36-7
CAS NO.：700-36-7
Empirical Formula: C6H3BrFNO2
Molecular Weight: 220
MDL number: MFCD00792441
EINECS: 670-950-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| 100G | RMB862.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44 °C |
| Boiling point: | 70-75 °C(Press: 0.4 Torr) |
| Density | 1.808±0.06 g/cm3(Predicted) |
| refractive index | 1.57 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | Pale yellow to green |
| InChI | InChI=1S/C6H3BrFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
| InChIKey | VGYVBEJDXIPSDL-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 700-36-7 |
Description and Uses
2-Bromo-4-fluoro-1-nitrobenzene can be used as a valuable building block, mainly for the preparation of Benzimidazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| HS Code | 29049090 |
