A3383612
3,4-Difluoronitrobenzene , ≥98.0%(GC) , 369-34-6
Synonym(s):
1,2-Difluoro-4-nitrobenzene
CAS NO.:369-34-6
Empirical Formula: C6H3F2NO2
Molecular Weight: 159.09
MDL number: MFCD00007198
EINECS: 206-718-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB28.00 | In Stock |
|
| 50G | RMB55.20 | In Stock |
|
| 100G | RMB84.00 | In Stock |
|
| 250G | RMB207.20 | In Stock |
|
| 500G | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -12C |
| Boiling point: | 76-80 °C/11 mmHg (lit.) |
| Density | 1.437 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 177 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Liquid |
| Specific Gravity | 1.437 |
| color | Clear yellow |
| Water Solubility | insoluble |
| BRN | 1944996 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3F2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| InChIKey | RUBQQRMAWLSCCJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)c(F)c1 |
| CAS DataBase Reference | 369-34-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Difluoronitrobenzene(369-34-6) |
Description and Uses
3,4-Difluoronitrobenzene was used in the preparation of xanthones and acridones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | CZ5710000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






