A1464312
6-Bromo-1H-benzimidazole , 97% , 4887-88-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB38.40 | In Stock |
|
| 5G | RMB146.40 | In Stock |
|
| 25G | RMB503.20 | In Stock |
|
| 100g | RMB1444.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130 °C |
| Boiling point: | 417.4±18.0 °C(Predicted) |
| Density | 1.770±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 11.19±0.30(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C7H5BrN2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H,(H,9,10) |
| InChIKey | GEDVWGDBMPJNEV-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(Br)=CC=C2N=1 |
Description and Uses
5-Bromo-1H-benzimidazole is a key intermediate in the synthesis of various organic compounds, especially in the fields of medicine and chemical research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-36-22 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
