M1582335
N-Phenethylbiguanide , 95% , 114-86-3
CAS NO.：114-86-3
Empirical Formula: C10H15N5
Molecular Weight: 205.26
MDL number: MFCD00242966
EINECS: 204-057-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB200.00 | In Stock |
|
| 1g | RMB486.40 | In Stock |
|
| 5g | RMB1260.80 | In Stock |
|
| 25g | RMB3728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176.5 °C |
| Boiling point: | 333.94°C (rough estimate) |
| Density | 1.0541 (rough estimate) |
| refractive index | 1.6380 (estimate) |
| storage temp. | RT, protect from light |
| pka | pKa 3.1/12.9±0.01(H2O,t =25,I>0.1) (Uncertain) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H15N5/c11-9(12)15-10(13)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H6,11,12,13,14,15) |
| InChIKey | ICFJFFQQTFMIBG-UHFFFAOYSA-N |
| SMILES | C(=N)(NCCC1=CC=CC=C1)NC(=N)N |
| CAS DataBase Reference | 114-86-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Imidodicarbonimidic diamide, n-(2-phenylethyl)-(114-86-3) |
Description and Uses
N-Phenethylbiguanide is used in cancer treatment methods using thermotherapy and/or enhanced immunotherapy.
Safety
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | DU2200000 |
| HS Code | 2925290090 |
| Hazardous Substances Data | 114-86-3(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 1650 mg/kg BCFAAI 110,470,71 |
