A1465850
4-Borono-L-phenylalanine , ≥98% , 76410-58-7
Synonym(s):
L -BPA;4-Dihydroxyboryl-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB39.20 | In Stock |
|
| 250mg | RMB158.40 | In Stock |
|
| 1g | RMB559.20 | In Stock |
|
| 5g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285-293℃ (dec.) |
| Boiling point: | 449.3±55.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Aqueous Acid (Slightly) |
| pka | 2.20±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| BRN | 4458616 |
| InChI | InChI=1S/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | NFIVJOSXJDORSP-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(B(O)O)C=C1)N |
| CAS DataBase Reference | 76410-58-7(CAS DataBase Reference) |
Description and Uses
4-Borono-L-phenylalanine is an unnatural derivative of L-Phenylalanine (P319415). a nonpolar, essential amino acid that naturally occurs in the human body and is also used to treat patients with depression. 4-Borono-L-phenylalanine is also being used as a mediator in sequential boron neutron capture therapy, a new method of treating oral cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 1-10 |
| HazardClass | IRRITANT |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







