A4995912
4-Iodo-L-phenylalanine , 96% , 24250-85-9
Synonym(s):
(S)-2-Amino-3-(4-iodophenyl)propanoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB100.00 | In Stock |
|
| 25G | RMB385.60 | In Stock |
|
| 100g | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255-256 °C |
| Boiling point: | 366.8±32.0 °C(Predicted) |
| Density | 1.824±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.19±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Partly miscible with water. |
| Sensitive | Light Sensitive |
| BRN | 4411317 |
| InChI | InChI=1S/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | PZNQZSRPDOEBMS-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(I)C=C1)N |
| CAS DataBase Reference | 24250-85-9(CAS DataBase Reference) |
Description and Uses
4-Iodo-L-phenylalanine may be used in protein engineering as a model unnatural α amino acid to alter primary amino acid composition via the opal (UGA) codon.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Irritant |
| HS Code | 2922498590 |
