PRODUCT Properties
| Melting point: | 241℃ (Decomposition) |
| Boiling point: | 506.0±50.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 3.16±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | 1S/C12H16N2O3/c1-8(12(16)17)14-11(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | MIDZLCFIAINOQN-WPRPVWTQSA-N |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(O)=O |
| CAS DataBase Reference | 3918-87-4 |
Description and Uses
Phenylalanylalanine (H-Phe-Ala-OH) is a dipeptide composed of phenylalanine and alanine. Phenylalanylalanine is an incomplete breakdown product of protein digestion or protein catabolism[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
