A1470112
4-(Bromomethyl)phenylacetic acid , ≥98.0% , 13737-36-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB359.20 | In Stock |
|
| 100G | RMB1343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-183 °C(lit.) |
| Boiling point: | 343.1±22.0 °C(Predicted) |
| Density | 1.565±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 4.24±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light beige |
| BRN | 2360711 |
| InChI | InChI=1S/C9H9BrO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChIKey | WCOCCXZFEJGHTC-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 13737-36-5(CAS DataBase Reference) |
Description and Uses
4-(Bromomethyl)phenylacetic acid was used as the precursor for serine protease inhibitor. It was also used in the synthesis of a novel crown ether receptor and 4-(acetoxymethyl)phenylacetic acid by reacting with excessive sodium acetate and acetic acid.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H319-H334-H335-H314-H318 |
| Precautionary statements | P261-P305+P351+P338-P342+P311-P264-P280-P284-P302+P352+P332+P313+P362+P364-P304+P340+P342+P311-P305+P351+P338+P337+P313-P501-P260h-P301+P330+P331-P303+P361+P353-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-42 |
| Safety Statements | 26-36 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |





![2-[4-(Bromomethyl)phenyl]propionic Acid](https://img.chemicalbook.com/CAS/20180808/GIF/111128-12-2.gif)


