A1471312
Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride , ≥95.0%(GC) , 1719-83-1
Synonym(s):
Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic 2,3:5,6-dianhydride;Bicyclo[2.2.2]oct-7-ene-2,3:5,6-tetracarboxylic dianhydride;Bicyclooctenetetracarboxylic dianhydride
CAS NO.:1719-83-1
Empirical Formula: C12H8O6
Molecular Weight: 248.19
MDL number: MFCD00082228
EINECS: 217-009-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB335.20 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| 500g | RMB3655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 351.26°C (rough estimate) |
| Density | 1.4501 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water |
| Sensitive | Moisture Sensitive |
| BRN | 294213 |
| InChI | InChI=1S/C12H8O6/c13-9-5-3-1-2-4(7(5)11(15)17-9)8-6(3)10(14)18-12(8)16/h1-8H |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C=CC(C4C(=O)OC(=O)C43)C2C1=O |
| CAS DataBase Reference | 1719-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic acid dianhydride(1719-83-1) |
Description and Uses
Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride is used to prepare the thermo-cured cycloaliphatic polyamic acid and photo-cured cycloaliphatic polyamic ester, which were then converted to cycloaliphatic polyimide film.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2917 20 00 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic dianhydride](https://img.chemicalbook.com/CAS/GIF/1719-83-1.gif)

![Bicyclo[2.2.2]octane-2,5-dione](https://img.chemicalbook.com/CAS/GIF/57346-05-1.gif)


