PRODUCT Properties
| Melting point: | 151-152 °C |
| Boiling point: | 338.1±25.0 °C(Predicted) |
| Density | 1.635±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 4.08±0.10(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C8H7BrO2/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | FTPAHNNMUYOHOB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(CBr)=C1 |
| CAS DataBase Reference | 6515-58-8(CAS DataBase Reference) |
Description and Uses
3-(Bromomethyl)benzoic Acid is a compound useful in organic synthesis and other pharmacological processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






