A1479112
Boc-2-Abz-OH , ≥98% , 68790-38-5
Synonym(s):
N-Boc-anthranilic acid;2-(Boc-amino)benzoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB199.20 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 10G | RMB1399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156 °C (dec.) |
| Boiling point: | 328.6±25.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.67±0.36(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 2848891 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H15NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8(9)10(14)15/h4-7H,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | BYGHHEDJDSLEKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1C(O)=O |
| CAS DataBase Reference | 68790-38-5 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302-H315-H317-H319-H335 |
| Precautionary statements | P210-P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







