A1480812
2-Bromo-4′-nitroacetophenone , ≥98.0%(GC) , 99-81-0
Synonym(s):
ω-Bromo-4-nitroacetophenone;4-Nitrophenacyl bromide
CAS NO.:99-81-0
Empirical Formula: C8H6BrNO3
Molecular Weight: 244.04
MDL number: MFCD00007356
EINECS: 202-789-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB60.00 | In Stock |
|
| 100G | RMB236.00 | In Stock |
|
| 500g | RMB1104.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-99 °C(lit.) |
| Boiling point: | 325.2±17.0 °C(Predicted) |
| Density | 1.8033 (rough estimate) |
| refractive index | 1.6090 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Yellow to orange |
| BRN | 393567 |
| InChI | InChI=1S/C8H6BrNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChIKey | MBUPVGIGAMCMBT-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C([N+]([O-])=O)C=C1)CBr |
| CAS DataBase Reference | 99-81-0(CAS DataBase Reference) |
| NIST Chemistry Reference | p-Nitrophenacyl bromide(99-81-0) |
| EPA Substance Registry System | 2-Bromo-4'-nitroacetophenone (99-81-0) |
Description and Uses
2-Bromo-4′-nitroacetophenone was used to study the pKa of the histidine-34 imidazole.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





