A1369912
2-Bromo-2′-nitroacetophenone , 98% , 6851-99-6
Synonym(s):
2′-Nitrophenacyl bromide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB99.20 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100g | RMB1703.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-57 °C(lit.) |
| Boiling point: | 335.7±17.0 °C(Predicted) |
| Density | 1.671±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Crystalline Powder |
| color | White to pale yellow |
| λmax | 262nm(EtOH)(lit.) |
| InChI | 1S/C8H6BrNO3/c9-5-8(11)6-3-1-2-4-7(6)10(12)13/h1-4H,5H2 |
| InChIKey | SGXUUCSRVVSMGK-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccccc1C(=O)CBr |
| CAS DataBase Reference | 6851-99-6(CAS DataBase Reference) |
Description and Uses
2-Bromo-2′-nitroacetophenone, an electroactive derivative-forming reagent, was used as a precolumn reagent for preparing prostaglandin derivatives.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







