A6160212
3′-Nitroacetophenone , 98% , 121-89-1
Synonym(s):
m-nitroacetophenone
CAS NO.:121-89-1
Empirical Formula: C8H7NO3
Molecular Weight: 165.15
MDL number: MFCD00007259
EINECS: 204-504-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB52.00 | In Stock |
|
| 250g | RMB79.20 | In Stock |
|
| 500G | RMB149.60 | In Stock |
|
| 1kg | RMB278.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 202 °C(lit.) |
| Density | 1.3450 (rough estimate) |
| vapor pressure | 0.32Pa at 25℃ |
| refractive index | 1.5468 (estimate) |
| Flash point: | 202°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | Yellow to yellow-green |
| Odor | Odorless |
| Water Solubility | <0.01 g/100 mL at 20 ºC |
| BRN | 743002 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C8H7NO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5H,1H3 |
| InChIKey | ARKIFHPFTHVKDT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(c1)[N+]([O-])=O |
| LogP | 1.42 |
| NIST Chemistry Reference | 3-Nitroacetophenone(121-89-1) |
| EPA Substance Registry System | 3-Nitroacetophenone (121-89-1) |
Description and Uses
3′-Nitroacetophenone can undergo high hydrostatic pressure-assisted reduction with Ni–Al alloy in water to form 1-(3-aminophenyl)ethanol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 21 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | AM9625000 |
| TSCA | TSCA listed |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |
| Hazardous Substances Data | 121-89-1(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),National Technical Information Service. Vol. AD277-689, |







