A1453412
3-Bromobenzyl bromide , ≥95.0%(GC) , 823-78-9
Synonym(s):
α,3-Dibromotoluene
CAS NO.：823-78-9
Empirical Formula: C7H6Br2
Molecular Weight: 249.93
MDL number: MFCD00000176
EINECS: 212-519-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB216.80 | In Stock |
|
| 250g | RMB471.20 | In Stock |
|
| 500G | RMB932.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-41 °C(lit.) |
| Boiling point: | 130 °C12 mm Hg |
| Density | 1,56 g/cm3 |
| refractive index | 1.6066 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Adhering Crystals or Crystalline Powder |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 2078683 |
| InChI | InChI=1S/C7H6Br2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | ZPCJPJQUVRIILS-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(CBr)=C1 |
| CAS DataBase Reference | 823-78-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1-bromo-3-(bromomethyl)- (823-78-9) |
Description and Uses
3-Bromobenzyl bromide was used in the synthesis of:
- 1,7-di(3-bromobenzyl)cyclen
- substituted 8-arylquinoline, phosphodiesterase 4 (PDE4) inhibitors
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
