A1210812
3-Bromobenzyl Alcohol , 99% , 15852-73-0
CAS NO.：15852-73-0
Empirical Formula: C7H7BrO
Molecular Weight: 187.03
MDL number: MFCD00004629
EINECS: 239-975-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB220.80 | In Stock |
|
| 500G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 |
| Boiling point: | 165 °C16 mm Hg(lit.) |
| Density | 1.56 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | clear liquid |
| pka | 14.28±0.10(Predicted) |
| Specific Gravity | 1.560 |
| color | Colorless to Light yellow to Light orange |
| BRN | 2242512 |
| InChI | InChI=1S/C7H7BrO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2 |
| InChIKey | FSWNRRSWFBXQCL-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC(Br)=C1 |
| CAS DataBase Reference | 15852-73-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Bromobenzyl alcohol(15852-73-0) |
Description and Uses
3-Bromobenzyl alcohol was employed in the preparation of tert-butyl 3-(3-bromophenyl)-2-cyanopropanoate and silyl ether.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062900 |
