A6202812
3-Nitrobenzyl bromide , >98.0%(GC) , 3958-57-4
Synonym(s):
α-Bromo-m-nitrotoluene
CAS NO.:3958-57-4
Empirical Formula: C7H6BrNO2
Molecular Weight: 216.03
MDL number: MFCD00007271
EINECS: 223-557-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100G | RMB561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-59 °C(lit.) |
| Boiling point: | 153-154 °C (7 mmHg) |
| Density | 1.6841 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | 153-154°C/7mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Dichloromethane, Hot Ethanol |
| form | Crystalline Powder or Crystals |
| color | Yellow to light brown |
| Water Solubility | insoluble |
| BRN | 742795 |
| InChI | 1S/C7H6BrNO2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5H2 |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(CBr)c1 |
| CAS DataBase Reference | 3958-57-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(bromomethyl)-3-nitro-(3958-57-4) |
| EPA Substance Registry System | Benzene, 1-(bromomethyl)-3-nitro- (3958-57-4) |
Description and Uses
3-Nitrobenzyl bromide was used in the synthesis of 1,4-disubstituted imidazoles.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








