A6155712
2'-Nitroacetophenone , 95% , 577-59-3
CAS NO.：577-59-3
Empirical Formula: C8H7NO3
Molecular Weight: 165.15
MDL number: MFCD00007144
EINECS: 209-414-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100g | RMB291.20 | In Stock |
|
| 500g | RMB1259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 202 °C(lit.) |
| Density | 1.23 |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| color | Brown |
| Water Solubility | Insoluble |
| FreezingPoint | 24.0 to 28.0 ℃ |
| BRN | 1102322 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H7NO3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3 |
| InChIKey | SUGXZLKUDLDTKX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference | 577-59-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(2-nitrophenyl)-(577-59-3) |
| EPA Substance Registry System | 2-Nitroacetophenone (577-59-3) |
Description and Uses
2'-Nitroacetophenone is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and dyestuff. It is also used as a synthetic reagent. It is the sensitizer which can be used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | AM9625000 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HS Code | 29147090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
