A1486512
Benzidine dihydrochloride solution , analyticalstandard,1000μg/ml,inmethanol , 531-85-1
Synonym(s):
4,4′-Diaminobiphenyl dihydrochloride
CAS NO.:531-85-1
Empirical Formula: C12H13ClN2
Molecular Weight: 220.7
MDL number: MFCD00040389
EINECS: 208-519-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| form | powder |
| color | Leaflets |
| Water Solubility | 0.1-0.5 g/100 mL at 23.5 ºC |
| BRN | 3914846 |
| InChI | InChI=1S/C12H12N2.ClH/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H,13-14H2;1H |
| InChIKey | FYRTZXXTIDKEJD-UHFFFAOYSA-N |
| SMILES | NC1C=CC(C2C=CC(N)=CC=2)=CC=1.Cl |
| CAS DataBase Reference | 531-85-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzidine dihydrochloride (531-85-1) |
Description and Uses
The dihydrochlorie salt of Benzidine (B121000) a common used in dyes and environmental testing.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H350-H410 |
| Precautionary statements | P264-P270-P201-P202-P280-P273-P301+P312-P330-P308+P313-P391-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N,Xn |
| Risk Statements | 45-22-50/53-36/37/38-20/21/22 |
| Safety Statements | 53-45-60-61-36-26 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DD0600000 |
| TSCA | TSCA listed |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1A |
| Toxicity | mmo-sat 100 nmol/plate MUREAV 136,33,84 |






![2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/5177-43-5.gif)


