PRODUCT Properties
| Melting point: | 85-87 °C(lit.) |
| Boiling point: | 275.6±30.0 °C(Predicted) |
| Density | 1.870±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.65±0.24(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| InChI | InChI=1S/C7H7Br2N/c8-4-6-2-1-3-7(5-9)10-6/h1-3H,4-5H2 |
| InChIKey | QUTSYCOAZVHGGT-UHFFFAOYSA-N |
| SMILES | C1(CBr)=NC(CBr)=CC=C1 |
Description and Uses
2,6-Bis(bromomethyl)pyridine may be used in the preparation of the following:
- a new pyridine-pyrazole derivative, 2,6-bis(3,5-diphenylpyrazol-1-ylmethyl)pyridine
- a large macrocyclic ligand, N(1),N(7)-pyridine-2,6-dimethyl-N(2),N(6)-bis(6-(3-(1H-benzo[d]imidazol-1-yl)propanamido)pyridin-2-yl)pyridine-2,6-dicarboxamide dibromide
- small-ring, potentially tridentate Se(2)N(pyridyl)-donor macrocycles
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






