A1496112
6-Bromo-2-pyridinecarboxylic Acid , >98.0%(GC) , 21190-87-4
Synonym(s):
6-Bromopicolinic acid
CAS NO.：21190-87-4
Empirical Formula: C6H4BrNO2
Molecular Weight: 202.01
MDL number: MFCD00093197
EINECS: 628-217-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB343.20 | In Stock |
|
| 25G | RMB1199.20 | In Stock |
|
| 100G | RMB3199.20 | In Stock |
|
| 500G | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-194 °C(lit.) |
| Boiling point: | 352.8±27.0 °C(Predicted) |
| Density | 1.813±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 3.25±0.10(Predicted) |
| color | Off-white to tan |
| InChI | InChI=1S/C6H4BrNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10) |
| InChIKey | XURXQNUIGWHWHU-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 21190-87-4(CAS DataBase Reference) |
Description and Uses
Used in synthesis of chiral 2,2′-dipyidylamines
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
