A1497912
Biphenyl-3-carboxaldehyde , >96.0%(GC) , 1204-60-0
Synonym(s):
3-Phenylbenzaldehyde
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB100.00 | In Stock |
|
| 1G | RMB266.40 | In Stock |
|
| 5G | RMB1014.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-168 °C |
| Boiling point: | 125°C/1mmHg(lit.) |
| Density | 1.118 g/mL at 25 °C |
| refractive index | 1.6290-1.6330 |
| Flash point: | >110℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C13H10O/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-10H |
| InChIKey | KFKSIUOALVIACE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(C=O)=C1 |
| CAS DataBase Reference | 1204-60-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36/37/39 |
| WGK Germany | 3 |
| RTECS | DV1771500 |
| Hazard Note | Irritant |
| HS Code | 2912290090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




