A6835512
3-Phenoxybenzaldehyde , ≥97.0%(GC) , 39515-51-0
CAS NO.:39515-51-0
Empirical Formula: C13H10O2
Molecular Weight: 198.22
MDL number: MFCD00003353
EINECS: 254-487-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB98.40 | In Stock |
|
| 25G | RMB358.40 | In Stock |
|
| 100G | RMB1006.40 | In Stock |
|
| 500G | RMB3598.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13 °C |
| Boiling point: | 169-169.5 °C11 mm Hg(lit.) |
| Density | 1.147 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| Sensitive | Air Sensitive |
| BRN | 511662 |
| InChI | InChI=1S/C13H10O2/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-10H |
| InChIKey | MRLGCTNJRREZHZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(OC2=CC=CC=C2)=C1 |
| CAS DataBase Reference | 39515-51-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 3-phenoxy- (39515-51-0) |
Description and Uses
3-phenoxybenzaldehyde is an important intermediate for the synthesis of pyrethroid pesticides phenothrin, cypermethrin, deltamethrin,fenvalerate, fenpropathrin, flucythrinate, cyhalothrin, etc.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-26 |
| Safety Statements | 23-24/25-45-38-28 |
| RIDADR | UN2810 - class 6.1 - PG 3 - EHS - Toxic, liquids, organic, n.o.s., HI: all |
| WGK Germany | 3 |
| RTECS | CU7560200 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29124900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity | LD ipr-mus: >500 mg/kg JAFCAU26,954,78 |







