A7634112
3,4,5-Trimethoxybenzaldehyde , 98% , 86-81-7
CAS NO.:86-81-7
Empirical Formula: C10H12O4
Molecular Weight: 196.2
MDL number: MFCD00003364
EINECS: 201-701-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB84.80 | In Stock |
|
| 500G | RMB313.60 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-74 °C (lit.) |
| Boiling point: | 163-165 °C/10 mmHg (lit.) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5550 (estimate) |
| Flash point: | 163-165°C/10mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | Powder or Flakes |
| color | White to creamy |
| Water Solubility | slightly soluble |
| Sensitive | Air Sensitive |
| BRN | 395163 |
| Stability: | Hygroscopic |
| InChI | 1S/C10H12O4/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-6H,1-3H3 |
| InChIKey | OPHQOIGEOHXOGX-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc(OC)c(OC)c(OC)c1 |
| LogP | 1.390 |
| CAS DataBase Reference | 86-81-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 3,4,5-trimethoxy-(86-81-7) |
| EPA Substance Registry System | Benzaldehyde, 3,4,5-trimethoxy- (86-81-7) |
Description and Uses
3,4,5-Trimethoxybenzaldehyde (cas# 86-81-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 22-24/25-45-36/37/39-27-26 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | CU8462000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29124900 |
| Storage Class | 11 - Combustible Solids |







