A7698012
3,4,5-Trimethoxyphenylacetic acid , 98% , 951-82-6
CAS NO.：951-82-6
Empirical Formula: C11H14O5
Molecular Weight: 226.23
MDL number: MFCD00004336
EINECS: 213-456-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB302.40 | In Stock |
|
| 100G | RMB1109.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-120 °C (lit.) |
| Boiling point: | 327.83°C (rough estimate) |
| Density | 1.2668 (rough estimate) |
| refractive index | 1.5140 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.23±0.10(Predicted) |
| color | White to cream |
| Water Solubility | SOLUBLE |
| BRN | 2697844 |
| InChI | InChI=1S/C11H14O5/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | DDSJXCGGOXKGSJ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 951-82-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4,5-Trimethoxyphenylacetic acid(951-82-6) |
Description and Uses
3,4,5-Trimethoxyphenylacetic Acid is a reagent in the preparation of 3-phenylcoumarins as antidepressant agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 38-36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189090 |
