A7741212
3-(Trifluoromethyl)benzaldehyde , 97% , 454-89-7
Synonym(s):
α,α,α-Trifluoro-m-tolualdehyde
CAS NO.:454-89-7
Empirical Formula: C8H5F3O
Molecular Weight: 174.12
MDL number: MFCD00003373
EINECS: 207-228-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB44.80 | In Stock |
|
| 25G | RMB76.80 | In Stock |
|
| 100G | RMB240.00 | In Stock |
|
| 500g | RMB1006.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-86 °C30 mm Hg(lit.) |
| Density | 1.301 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to very slightly orange |
| Specific Gravity | 1.301 |
| Sensitive | Air Sensitive |
| BRN | 2327537 |
| InChI | 1S/C8H5F3O/c9-8(10,11)7-3-1-2-6(4-7)5-12/h1-5H |
| InChIKey | NMTUHPSKJJYGML-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cccc(c1)C(F)(F)F |
| CAS DataBase Reference | 454-89-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 3-(trifluoromethyl)-(454-89-7) |
| EPA Substance Registry System | Benzaldehyde, 3-(trifluoromethyl)- (454-89-7) |
Description and Uses
3-(Trifluoromethyl)benzaldehyde is used as a reagent in the synthesis of 2,3-di- and 2,2,3-trisubstituted-3-methoxycarbonyl-╬│-butyrolactones as potent antitumor agents. Also used as a reagent in the synthesis of novel chalcone derivatives as hypoxia-inducible factor (HIF)-1 inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H410 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







