A7719312
4-(Trifluoromethyl)benzoyl chloride , 98% , 329-15-7
Synonym(s):
α,α,α-Trifluoro-p-toluoyl chloride
CAS NO.:329-15-7
Empirical Formula: C8H4ClF3O
Molecular Weight: 208.57
MDL number: MFCD00000694
EINECS: 206-342-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB352.00 | In Stock |
|
| 500G | RMB1379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -3°C |
| Boiling point: | 188-190 °C(lit.) |
| Density | 1.404 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 173 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| Specific Gravity | 1.404 |
| color | Clear colorless to yellow |
| Water Solubility | decomposes |
| Sensitive | Lachrymatory |
| BRN | 391282 |
| InChI | 1S/C8H4ClF3O/c9-7(13)5-1-3-6(4-2-5)8(10,11)12/h1-4H |
| InChIKey | OXZYBOLWRXENKT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(cc1)C(Cl)=O |
| CAS DataBase Reference | 329-15-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(Trifluoromethyl)benzoyl chloride(329-15-7) |
| EPA Substance Registry System | Benzoyl chloride, 4-(trifluoromethyl)- (329-15-7) |
Description and Uses
4-(Trifluoromethyl)benzoyl chloride is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuff.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-29 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





