A1514412
2-Bromobenzoyl Chloride , 98% , 7154-66-7
CAS NO.:7154-66-7
Empirical Formula: C7H4BrClO
Molecular Weight: 219.46
MDL number: MFCD00000655
EINECS: 230-507-4
Update time: 2022-07-08
PRODUCT Properties
Melting point: | 8-10 °C(lit.) |
Boiling point: | 245 °C(lit.) |
Density | 1.679 g/mL at 25 °C(lit.) |
refractive index | n |
Flash point: | >230 °F |
storage temp. | 0-6°C |
solubility | soluble in Chloroform, Methanol |
form | Liquid |
Specific Gravity | 1.680 |
color | Clear colorless to light yellow |
Sensitive | Moisture Sensitive |
BRN | 508506 |
InChI | InChI=1S/C7H4BrClO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H |
InChIKey | NZCKTGCKFJDGFD-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)C1=CC=CC=C1Br |
CAS DataBase Reference | 7154-66-7(CAS DataBase Reference) |
NIST Chemistry Reference | 2-Bromobenzoyl chloride(7154-66-7) |
Description and Uses
2-Bromobenzoyl chloride is used in synthetic chemistry as an acylating agent. 2-Bromobenzoyl chloride is also used as a reagent to synthesize fluorazone, a heteroaromatic compound that exhibits antidiabetic, psychostimulant and anticancer activity.
Safety
Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
Signal word | Danger |
Hazard statements | H314-H335 |
Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
Hazard Codes | C |
Risk Statements | 34-37 |
Safety Statements | 26-36/37/39-45 |
RIDADR | UN 3265 8/PG 2 |
WGK Germany | 3 |
RTECS | DM6635000 |
F | 8-10-19-21 |
Hazard Note | Corrosive |
HazardClass | 8 |
PackingGroup | II |
HS Code | 29163990 |