A1514412
2-Bromobenzoyl Chloride , 98% , 7154-66-7
CAS NO.:7154-66-7
Empirical Formula: C7H4BrClO
Molecular Weight: 219.46
MDL number: MFCD00000655
EINECS: 230-507-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8-10 °C(lit.) |
| Boiling point: | 245 °C(lit.) |
| Density | 1.679 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 0-6°C |
| solubility | soluble in Chloroform, Methanol |
| form | Liquid |
| Specific Gravity | 1.680 |
| color | Clear colorless to light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 508506 |
| InChI | InChI=1S/C7H4BrClO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H |
| InChIKey | NZCKTGCKFJDGFD-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1Br |
| CAS DataBase Reference | 7154-66-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromobenzoyl chloride(7154-66-7) |
Description and Uses
2-Bromobenzoyl chloride is used in synthetic chemistry as an acylating agent. 2-Bromobenzoyl chloride is also used as a reagent to synthesize fluorazone, a heteroaromatic compound that exhibits antidiabetic, psychostimulant and anticancer activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6635000 |
| F | 8-10-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





