A1516412
Bis(pentafluorophenyl)phenylphosphine , >98.0%(GC) , 5074-71-5
Synonym(s):
2,3,4,5,6,2′,3′,4′,5′,6′-Decafluorotriphenylphosphine;Bis(pentafluorophenyl)phenylphosphine;Decafluorotriphenylphosphine solution;DFTPP
CAS NO.:5074-71-5
Empirical Formula: C18H5F10P
Molecular Weight: 442.19
MDL number: MFCD00000291
EINECS: 225-780-1
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB79.20 | In Stock |
|
| 1G | RMB207.20 | In Stock |
|
| 5g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-60 °C (lit.) |
| Boiling point: | 105°C/0.3mm |
| Flash point: | >230 °F |
| storage temp. | room temp |
| solubility | Soluble in chloroform, dichloromethane, tetrahydrofuran, benzene, toluene, ethanol, methanol, and supercritical carbon dioxide. |
| form | Powder |
| color | white |
| Sensitive | air sensitive |
| BRN | 6253897 |
| Major Application | environmental |
| InChI | 1S/C18H5F10P/c19-7-9(21)13(25)17(14(26)10(7)22)29(6-4-2-1-3-5-6)18-15(27)11(23)8(20)12(24)16(18)28/h1-5H |
| InChIKey | OYNXPGGNQMSMTR-UHFFFAOYSA-N |
| SMILES | Fc1c(c(c(c(c1F)F)P(c3c(c(c(c(c3F)F)F)F)F)c2ccccc2)F)F |
| CAS DataBase Reference | 5074-71-5(CAS DataBase Reference) |
Description and Uses
Bis(pentafluorophenyl)phenylphosphine is used as a ligand involved in the palladium-catalyzed Heck reaction of iodobenzene and styrene in compressed carbon dioxide. It is also used in the polymerization of 1,3-butadiene with Co(2-ethyl hexanoate)2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | Xi,Xn,T,F |
| Risk Statements | 36/37/38-20/21/22-40-63-43-23/24/25-45-67-66-36/38-11-36 |
| Safety Statements | 26-36/37/39-22-36/37-24/25-23-53-16-9 |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | No |
| HS Code | 29310099 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |





