A1521212
2-Bromo-4'-phenylacetophenone , >98.0%(HPLC) , 135-73-9
Synonym(s):
ω-Bromo-4-phenylacetophenone;4-Phenylphenacyl bromide
CAS NO.:135-73-9
Empirical Formula: C14H11BrO
Molecular Weight: 275.14
MDL number: MFCD00000202
EINECS: 205-217-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB110.40 | In Stock |
|
| 25G | RMB210.40 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C(lit.) |
| Boiling point: | 370.0±17.0 °C(Predicted) |
| Density | 1.3930 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| form | Powder |
| color | Yellow to beige-brown |
| Sensitive | Lachrymatory |
| BRN | 513838 |
| InChI | 1S/C14H11BrO/c15-10-14(16)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | KGHGZRVXCKCJGX-UHFFFAOYSA-N |
| SMILES | BrCC(=O)c1ccc(cc1)-c2ccccc2 |
| CAS DataBase Reference | 135-73-9(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 1-[1,1'-biphenyl]-4-yl-2-bromo- (135-73-9) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 8-19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




