A1526012
4-Bromobenzohydrazide , >97.0% , 5933-32-4
CAS NO.：5933-32-4
Empirical Formula: C7H7BrN2O
Molecular Weight: 215.05
MDL number: MFCD00007602
EINECS: 227-681-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB181.60 | In Stock |
|
| 25G | RMB441.60 | In Stock |
|
| 100g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-169°C |
| Density | 1.615±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 12.09±0.10(Predicted) |
| color | Light beige |
| Water Solubility | Soluble in hot methanol (almost transparency). Slightly soluble in water. |
| BRN | 777006 |
| InChI | InChI=1S/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | UYIMBYKIIMYFPS-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=C(Br)C=C1 |
| CAS DataBase Reference | 5933-32-4(CAS DataBase Reference) |
Description and Uses
4-Bromobenzoic hydrazide has been used in the preparation of {2-[1-oxo-3-(4-bromophenyl)-2-propenyl]hydrazide}-4-bromobenzoic acid, {2,2?-[1,4-phenylenebis(1-oxo-2-propene-3,1-diyl)]dihydrazide}-p-bromobenzoic acid and substituted period[1,2-a]pyrimidine-2,4(3H)-diones (PPMDO).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| RTECS | DG4449250 |
| HS Code | 29280000 |
